Benzene and substituted derivatives
Filtered Search Results
p-Toluic acid, 98%
CAS: 99-94-5 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002565 InChI Key: LPNBBFKOUUSUDB-UHFFFAOYSA-N Synonym: p-toluic acid,4-toluic acid,crithminic acid,p-methylbenzoic acid,p-toluylic acid,benzoic acid, 4-methyl,p-carboxytoluene,para-toluic acid,4-methyl-benzoic acid,toluenecarboxylic acid PubChem CID: 7470 ChEBI: CHEBI:36635 IUPAC Name: 4-methylbenzoic acid SMILES: CC1=CC=C(C=C1)C(O)=O
| PubChem CID | 7470 |
|---|---|
| CAS | 99-94-5 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:36635 |
| MDL Number | MFCD00002565 |
| SMILES | CC1=CC=C(C=C1)C(O)=O |
| Synonym | p-toluic acid,4-toluic acid,crithminic acid,p-methylbenzoic acid,p-toluylic acid,benzoic acid, 4-methyl,p-carboxytoluene,para-toluic acid,4-methyl-benzoic acid,toluenecarboxylic acid |
| IUPAC Name | 4-methylbenzoic acid |
| InChI Key | LPNBBFKOUUSUDB-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Isophthalaldehyde, 99%
CAS: 626-19-7 Molecular Formula: C8H6O2 Molecular Weight (g/mol): 134.13 MDL Number: MFCD00003372 InChI Key: IZALUMVGBVKPJD-UHFFFAOYSA-N Synonym: isophthalaldehyde,m-phthalaldehyde,1,3-benzenedicarboxaldehyde,1,3-benzenedialdehyde,isophtaldehydes,isophthaldehyde,isophthaldialdehyde,isophtaldehydes french,isophthalic dicarboxaldehyde,unii-lu162b2n9x PubChem CID: 34777 IUPAC Name: benzene-1,3-dicarbaldehyde SMILES: C1=CC(=CC(=C1)C=O)C=O
| PubChem CID | 34777 |
|---|---|
| CAS | 626-19-7 |
| Molecular Weight (g/mol) | 134.13 |
| MDL Number | MFCD00003372 |
| SMILES | C1=CC(=CC(=C1)C=O)C=O |
| Synonym | isophthalaldehyde,m-phthalaldehyde,1,3-benzenedicarboxaldehyde,1,3-benzenedialdehyde,isophtaldehydes,isophthaldehyde,isophthaldialdehyde,isophtaldehydes french,isophthalic dicarboxaldehyde,unii-lu162b2n9x |
| IUPAC Name | benzene-1,3-dicarbaldehyde |
| InChI Key | IZALUMVGBVKPJD-UHFFFAOYSA-N |
| Molecular Formula | C8H6O2 |
4-Bromo-2-methylbenzaldehyde, 95%
CAS: 24078-12-4 Molecular Formula: C8H7BrO Molecular Weight (g/mol): 199.047 MDL Number: MFCD07787171 InChI Key: RCBPVESMGNZMSG-UHFFFAOYSA-N Synonym: 4-bromo-2-methyl-benzaldehyde,2-methyl-4-bromobenzaldehyde,5-bromo-2-formyltoluene,benzaldehyde, 4-bromo-2-methyl,acmc-1chij,4-brom-2-methylbenzaldehyd,ksc494k3j,4-bromo-2-methyl benzaldehyde,benzaldehyde,4-bromo-2-methyl PubChem CID: 13555150 IUPAC Name: 4-bromo-2-methylbenzaldehyde SMILES: CC1=C(C=CC(=C1)Br)C=O
| PubChem CID | 13555150 |
|---|---|
| CAS | 24078-12-4 |
| Molecular Weight (g/mol) | 199.047 |
| MDL Number | MFCD07787171 |
| SMILES | CC1=C(C=CC(=C1)Br)C=O |
| Synonym | 4-bromo-2-methyl-benzaldehyde,2-methyl-4-bromobenzaldehyde,5-bromo-2-formyltoluene,benzaldehyde, 4-bromo-2-methyl,acmc-1chij,4-brom-2-methylbenzaldehyd,ksc494k3j,4-bromo-2-methyl benzaldehyde,benzaldehyde,4-bromo-2-methyl |
| IUPAC Name | 4-bromo-2-methylbenzaldehyde |
| InChI Key | RCBPVESMGNZMSG-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO |
Benzoic Acid, FCC, 99.5-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N IUPAC Name: benzoic acid SMILES: OC(=O)C1=CC=CC=C1
| CAS | 65-85-0 |
|---|---|
| Molecular Weight (g/mol) | 122.12 |
| SMILES | OC(=O)C1=CC=CC=C1 |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Methyl Benzoylformate, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 15206-55-0
| CAS | 15206-55-0 |
|---|
3-Cyanobenzaldehyde, 99%
CAS: 24964-64-5 MDL Number: MFCD00003344 InChI Key: HGZJJKZPPMFIBU-UHFFFAOYSA-N Synonym: 3-cyanobenzaldehyde,m-cyanobenzaldehyde,benzonitrile, 3-formyl,m-formylbenzonitrile,m-cyanobenazldehyde,3-cyano benzaldehyde,3-formyl-benzonitrile,3-formylbenzenecarbonitrile,3cyano-benzaldehyde,m-cyano benzaldehyde PubChem CID: 90670 IUPAC Name: 3-formylbenzonitrile SMILES: C1=CC(=CC(=C1)C=O)C#N
| PubChem CID | 90670 |
|---|---|
| CAS | 24964-64-5 |
| MDL Number | MFCD00003344 |
| SMILES | C1=CC(=CC(=C1)C=O)C#N |
| Synonym | 3-cyanobenzaldehyde,m-cyanobenzaldehyde,benzonitrile, 3-formyl,m-formylbenzonitrile,m-cyanobenazldehyde,3-cyano benzaldehyde,3-formyl-benzonitrile,3-formylbenzenecarbonitrile,3cyano-benzaldehyde,m-cyano benzaldehyde |
| IUPAC Name | 3-formylbenzonitrile |
| InChI Key | HGZJJKZPPMFIBU-UHFFFAOYSA-N |
p-Dimethylamino)benzaldehyde ACS AR, Macron Fine Chemicals™
CAS: 100-10-7 Molecular Formula: C9H11NO Molecular Weight (g/mol): 149.19 MDL Number: MFCD00003381 InChI Key: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
| PubChem CID | 7479 |
|---|---|
| CAS | 100-10-7 |
| Molecular Weight (g/mol) | 149.19 |
| MDL Number | MFCD00003381 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| IUPAC Name | 4-(dimethylamino)benzaldehyde |
| InChI Key | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO |
Di-n-heptyl phthalate, 98+%
CAS: 3648-21-3 Molecular Formula: C22H34O4 Molecular Weight (g/mol): 362.51 MDL Number: MFCD00043680 InChI Key: JQCXWCOOWVGKMT-UHFFFAOYSA-N Synonym: diheptyl phthalate,di-n-heptyl phthalate,heptyl phthalate,di-n-heptylphthalate,phthalic acid, diheptyl ester,phthalic acid diheptyl ester,1,2-benzenedicarboxylic acid, diheptyl ester,n-diheptyl phthalate,unii-ie05vo8p8p,diheptyl ester of phthalic acid PubChem CID: 19284 ChEBI: CHEBI:34677 IUPAC Name: diheptyl benzene-1,2-dicarboxylate SMILES: CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC
| PubChem CID | 19284 |
|---|---|
| CAS | 3648-21-3 |
| Molecular Weight (g/mol) | 362.51 |
| ChEBI | CHEBI:34677 |
| MDL Number | MFCD00043680 |
| SMILES | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC |
| Synonym | diheptyl phthalate,di-n-heptyl phthalate,heptyl phthalate,di-n-heptylphthalate,phthalic acid, diheptyl ester,phthalic acid diheptyl ester,1,2-benzenedicarboxylic acid, diheptyl ester,n-diheptyl phthalate,unii-ie05vo8p8p,diheptyl ester of phthalic acid |
| IUPAC Name | diheptyl benzene-1,2-dicarboxylate |
| InChI Key | JQCXWCOOWVGKMT-UHFFFAOYSA-N |
| Molecular Formula | C22H34O4 |
Cinnamylideneacetophenone, 98+%
CAS: 614-57-3 Molecular Formula: C17H14O Molecular Weight (g/mol): 234.298 MDL Number: MFCD00020692 InChI Key: QONKLJMPKWQQFG-HPIZBCMHSA-N Synonym: cinnamylideneacetophenone,cinnamalacetophenone,5-phenyl-2,4-pentadienophenone,5-phenylpenta-2,4-dienophenone,2e,4e-1,5-diphenylpenta-2,4-dien-1-one,?,e-1,5-diphenyl-2,4-pentadien-1-one,2,4-pentadienophenone, 5-phenyl,2,4-pentadien-1-one, 1,5-diphenyl-, ?,e,1,5-diphenyl-2,4-pentadien-1-one,2,4-pentadien-1-one, 1,5-diphenyl PubChem CID: 1549519 IUPAC Name: (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one SMILES: C1=CC=C(C=C1)C=CC=CC(=O)C2=CC=CC=C2
| PubChem CID | 1549519 |
|---|---|
| CAS | 614-57-3 |
| Molecular Weight (g/mol) | 234.298 |
| MDL Number | MFCD00020692 |
| SMILES | C1=CC=C(C=C1)C=CC=CC(=O)C2=CC=CC=C2 |
| Synonym | cinnamylideneacetophenone,cinnamalacetophenone,5-phenyl-2,4-pentadienophenone,5-phenylpenta-2,4-dienophenone,2e,4e-1,5-diphenylpenta-2,4-dien-1-one,?,e-1,5-diphenyl-2,4-pentadien-1-one,2,4-pentadienophenone, 5-phenyl,2,4-pentadien-1-one, 1,5-diphenyl-, ?,e,1,5-diphenyl-2,4-pentadien-1-one,2,4-pentadien-1-one, 1,5-diphenyl |
| IUPAC Name | (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
| InChI Key | QONKLJMPKWQQFG-HPIZBCMHSA-N |
| Molecular Formula | C17H14O |
3-(1,3-Thiazol-2-yl)benzoic acid, ≥97%, Thermo Scientific™
CAS: 847956-27-8 Molecular Formula: C10H7NO2S Molecular Weight (g/mol): 205.231 MDL Number: MFCD06797800 InChI Key: BLFSSABBFANDKK-UHFFFAOYSA-N PubChem CID: 21075087 IUPAC Name: 3-(1,3-thiazol-2-yl)benzoic acid SMILES: C1=CC(=CC(=C1)C(=O)O)C2=NC=CS2
| PubChem CID | 21075087 |
|---|---|
| CAS | 847956-27-8 |
| Molecular Weight (g/mol) | 205.231 |
| MDL Number | MFCD06797800 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NC=CS2 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)benzoic acid |
| InChI Key | BLFSSABBFANDKK-UHFFFAOYSA-N |
| Molecular Formula | C10H7NO2S |
4-n-Octylbenzoic acid, 99%
CAS: 3575-31-3 Molecular Formula: C15H22O2 Molecular Weight (g/mol): 234.339 MDL Number: MFCD00042649 InChI Key: ZQLDNJKHLQOJGE-UHFFFAOYSA-N Synonym: 4-n-octylbenzoic acid,benzoic acid, 4-octyl,p-octylbenzoic acid,para-octylbenzoic acid,benzoic acid, p-octyl,p-n-octyl benzoic acid,p-octyl benzoic acid,4-n-octylbenzoicacid,p-n-octylbenzoic acid,maybridge1_001984 PubChem CID: 19147 IUPAC Name: 4-octylbenzoic acid SMILES: CCCCCCCCC1=CC=C(C=C1)C(=O)O
| PubChem CID | 19147 |
|---|---|
| CAS | 3575-31-3 |
| Molecular Weight (g/mol) | 234.339 |
| MDL Number | MFCD00042649 |
| SMILES | CCCCCCCCC1=CC=C(C=C1)C(=O)O |
| Synonym | 4-n-octylbenzoic acid,benzoic acid, 4-octyl,p-octylbenzoic acid,para-octylbenzoic acid,benzoic acid, p-octyl,p-n-octyl benzoic acid,p-octyl benzoic acid,4-n-octylbenzoicacid,p-n-octylbenzoic acid,maybridge1_001984 |
| IUPAC Name | 4-octylbenzoic acid |
| InChI Key | ZQLDNJKHLQOJGE-UHFFFAOYSA-N |
| Molecular Formula | C15H22O2 |
3-(4-Methoxybenzoyl)acrylic acid, 98%
CAS: 5711-41-1 Molecular Formula: C11H10O4 Molecular Weight (g/mol): 206.20 MDL Number: MFCD00020486 InChI Key: WORYXBDHTBWLLL-VOTSOKGWSA-N Synonym: 3-4-methoxybenzoyl acrylic acid,4-4-methoxyphenyl-4-oxobut-2-enoic acid,2e-4-4-methoxyphenyl-4-oxobut-2-enoic acid,3-p-methoxybenzoyl acrylic acid,acrylic acid, 3-p-methoxybenzoyl,trans-3-4-methoxybenzoyl acrylic acid,e-4-4-methoxyphenyl-4-oxobut-2-enoic acid,gamma-oxo-4-methoxybenzenecrotonic acid,4-4-methoxyphenyl-4-oxo-buten-2-saeure,4-4-methoxyphenyl-4-oxo-2-butenoic acid PubChem CID: 5355095 IUPAC Name: (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid SMILES: COC1=CC=C(C=C1)C(=O)\C=C\C(O)=O
| PubChem CID | 5355095 |
|---|---|
| CAS | 5711-41-1 |
| Molecular Weight (g/mol) | 206.20 |
| MDL Number | MFCD00020486 |
| SMILES | COC1=CC=C(C=C1)C(=O)\C=C\C(O)=O |
| Synonym | 3-4-methoxybenzoyl acrylic acid,4-4-methoxyphenyl-4-oxobut-2-enoic acid,2e-4-4-methoxyphenyl-4-oxobut-2-enoic acid,3-p-methoxybenzoyl acrylic acid,acrylic acid, 3-p-methoxybenzoyl,trans-3-4-methoxybenzoyl acrylic acid,e-4-4-methoxyphenyl-4-oxobut-2-enoic acid,gamma-oxo-4-methoxybenzenecrotonic acid,4-4-methoxyphenyl-4-oxo-buten-2-saeure,4-4-methoxyphenyl-4-oxo-2-butenoic acid |
| IUPAC Name | (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| InChI Key | WORYXBDHTBWLLL-VOTSOKGWSA-N |
| Molecular Formula | C11H10O4 |
2-[1-methyl-3-(trifluoromethyl)-1h-pyrazol-5-yl]benzoic acid, 97%, Thermo Scientific™
CAS: 910037-16-0 Molecular Formula: C12H9F3N2O2 Molecular Weight (g/mol): 270.211 MDL Number: MFCD09879926 InChI Key: ADEAPHCAMGDLFU-UHFFFAOYSA-N Synonym: 2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl benzoic acid,2-2-methyl-5-trifluoromethyl pyrazol-3-yl benzoic acid PubChem CID: 24229655 IUPAC Name: 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid SMILES: CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)O
| PubChem CID | 24229655 |
|---|---|
| CAS | 910037-16-0 |
| Molecular Weight (g/mol) | 270.211 |
| MDL Number | MFCD09879926 |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)O |
| Synonym | 2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl benzoic acid,2-2-methyl-5-trifluoromethyl pyrazol-3-yl benzoic acid |
| IUPAC Name | 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoic acid |
| InChI Key | ADEAPHCAMGDLFU-UHFFFAOYSA-N |
| Molecular Formula | C12H9F3N2O2 |
Pentafluorobenzaldehyde, 98%
CAS: 653-37-2 Molecular Formula: C7HF5O Molecular Weight (g/mol): 196.076 MDL Number: MFCD00003303 InChI Key: QJXCFMJTJYCLFG-UHFFFAOYSA-N Synonym: pentafluorobenzaldehyde,perfluorobenzaldehyde,benzaldehyde, pentafluoro,benzaldehyde, 2,3,4,5,6-pentafluoro,unii-s9yie3jz4k,pentafluor-benzaldehyd,s9yie3jz4k,pubchem4253,pentafluoro-benzaldehyde,acmc-209nqh PubChem CID: 69558 IUPAC Name: 2,3,4,5,6-pentafluorobenzaldehyde SMILES: C(=O)C1=C(C(=C(C(=C1F)F)F)F)F
| PubChem CID | 69558 |
|---|---|
| CAS | 653-37-2 |
| Molecular Weight (g/mol) | 196.076 |
| MDL Number | MFCD00003303 |
| SMILES | C(=O)C1=C(C(=C(C(=C1F)F)F)F)F |
| Synonym | pentafluorobenzaldehyde,perfluorobenzaldehyde,benzaldehyde, pentafluoro,benzaldehyde, 2,3,4,5,6-pentafluoro,unii-s9yie3jz4k,pentafluor-benzaldehyd,s9yie3jz4k,pubchem4253,pentafluoro-benzaldehyde,acmc-209nqh |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzaldehyde |
| InChI Key | QJXCFMJTJYCLFG-UHFFFAOYSA-N |
| Molecular Formula | C7HF5O |